Structure Descriptors

InChI

InChI=1S/C16H19ClN2.C13H18O2.C10H15NO/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13;1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15;1-8(11-2)10(12)9-6-4-3-5-7-9/h3-9,11,15H,10,12H2,1-2H3;4-7,9-10H,8H2,1-3H3,(H,14,15);3-8,10-12H,1-2H3/t;;8-,10+/m..0/s1

InChIKey

XVXGWWOWCFLBRO-WGZMRZIQSA-N

Smiles

CN[[email protected]@H](C)[[email protected]@H](O)c1ccccc1.CC(C)Cc2ccc(cc2)C(C)C(=O)O.CN(C)CCC(c3ccc(Cl)cc3)c4ccccn4

Source link